(m-Acrylamidophenyl)boronic acid
Catalog No: FT-0685348
CAS No: 99349-68-5
- Chemical Name: (m-Acrylamidophenyl)boronic acid
- Molecular Formula: C9H10BNO3
- Molecular Weight: 190.99
- InChI Key: ULVXDHIJOKEBMW-UHFFFAOYSA-N
- InChI: InChI=1S/C9H10BNO3/c1-2-9(12)11-8-5-3-4-7(6-8)10(13)14/h2-6,13-14H,1H2,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 190.992 |
|---|---|
| CAS: | 99349-68-5 |
| Flash_Point: | N/A |
| MF: | C9H10BNO3 |
| Symbol: | Warning |
| Bolling_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 3-Acrylamidophenylboronic acid |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 190.992 |
|---|---|
| MF: | C9H10BNO3 |
| Exact_Mass: | 191.075378 |
| Refractive_Index: | 1.562 |
| Density: | 1.2±0.1 g/cm3 |
| LogP: | 0.97 |
| PSA: | 69.56000 |
| Symbol: | GHS07 |
|---|---|
| Warning_Statement: | P280 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 + H312 + H332 |
| HS_Code: | 2931900090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)